Question
stringlengths
718
2.12k
Answer
stringclasses
2 values
TargetMolecule
stringlengths
8
284
SampleMethod
stringclasses
1 value
SampleNum
int64
4
4
SampleRep
stringclasses
1 value
image
imagewidth (px)
300
300
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)CC[C@@H](C(=O)[O-])[NH2+][C@@H](CCCC[NH3+])C(=O)N2CCC[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2CCC[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2[C@H]3CCC[C@H]3C[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2[C@H]3CCCC[C@@H]3C[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@@H](C(=O)N1CCC[C@H]1C(=O)[O-])[NH2+][C@@H](CCc2ccccc2)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@@H](C(=O)N1CCC[C@H]1C(=O)[O-])[NH2+][C@@H](CCc2ccccc2)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1cc(c(c(c1NC(=O)C[NH+](CC(=O)[O-])CC(=O)[O-])C)Br)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1cc(c(c(c1NC(=O)C[NH+](CC(=O)[O-])CC(=O)[O-])C)Br)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)[O-])SCC/[NH+]=C/N)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)[O-])SCC/[NH+]=C/N)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2Cc3cc(c(cc3C[C@H]2C(=O)[O-])OC)OC Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2Cc3ccccc3C[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(CCc1ccc(cc1)O)[NH2+]CCc2ccc(c(c2)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(CCc1ccccc1)[NH2+]CC(c2ccc(c(c2)C(=O)N)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@H]2CCc3ccccc3N(C2=O)CC(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@H]2CCc3ccccc3N(C2=O)CC(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1cc(oc1/C=N/N2CCOC2=O)[N+](=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1cc(ccc1c2ccc(o2)/C=N/N3CC(=O)NC3=O)[N+](=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(oc1/C=N/N2CC(=O)NC2=O)[N+](=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(oc1/C=N/N2CC(=O)NC2=O)[N+](=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCn1cc(c(=O)c2c1c(c(c(c2)F)N3CC[NH2+]C(C3)C)F)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCn1cc(c(=O)c2c1nc(c(c2)F)N3CC[NH2+]CC3)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c2c(cc(c1F)N3CC[NH2+]CC3)n(cc(c2=O)C(=O)[O-])C4CC4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@@H]1CN(C[C@@H]([NH2+]1)C)c2c(c(c3c(c2F)n(cc(c3=O)C(=O)[O-])C4CC4)N)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCn1cc(c(=O)c2c1cc(c(c2)F)N3CC[NH2+]CC3)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCn1cc(c(=O)c2c1cc(c(c2)F)N3CC[NH2+]CC3)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@@H]([C@@H](c1cccc(c1)O)O)[NH3+] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@@H]([C@@H](c1cccc(c1)O)O)[NH3+]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC[C@@H](C(=O)N)N1CCCC1=O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCC1(C(=O)C(CNC1=O)C)CC Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C=CN1CCCC1=O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C=CN1CCCC1=O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C(CC(=O)[O-])CO Clinical Trial Toxicity:
<boolean>Yes</boolean>
C(CC(=O)[O-])CO
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+](C)CCOC(=O)C(c1ccccc1)C2(CCCC2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+](C)CC(c1ccc(cc1)O)C2(CCCCC2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+](C)CC(c1ccc(cc1)OC)C2(CCCCC2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC[N+](C)(CC)CCOC(=O)C(c1ccccc1)(C2CCCCC2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CC[C@H](CCc2ccccc2)O)O)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(C)OC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1CC[C@H](CCc2ccccc2)O)O)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC#CCC(C)[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C/CCCC(=O)[O-])/C2)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)(C)[NH2+]CC(COc1cccc2c1C[C@@H]([C@@H](C2)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C#CC[NH2+][C@@H]1CCc2c1cccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@]12CC[C@@H]3c4ccc(cc4C[C@H]([C@H]3[C@@H]1CC[C@@H]2O)CCCCCCCCCS(=O)CCCC(C(F)(F)F)(F)F)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCCC[C@H](CC[C@H]1[C@@H]2Cc3cccc(c3C[C@@H]2C[C@@H]1O)OCC(=O)[O-])O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCC[C@H](CC[C@H]1[C@@H]2Cc3cccc(c3C[C@@H]2C[C@@H]1O)OCC(=O)[O-])O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH2+]/C(=C\[N+](=O)[O-])/NCCSCc1ccc(o1)C[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CN/C(=C\[N+](=O)[O-])/[NH2+]CCSCc1ccc(o1)C[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(oc1/C=N/NC(=O)N)[N+](=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(oc1/C=N/NC(=O)N)[N+](=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C(C(CS)S)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C(C(CS)S)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1c2c(cc(c1F)N3CC[NH2+]CC3)n(cc(c2=O)C(=O)[O-])C4CC4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@@H]1CN(C[C@@H]([NH2+]1)C)c2c(c(c3c(c2F)n(cc(c3=O)C(=O)[O-])C4CC4)N)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: Cc1c2c(cc(c1F)N3CC[NH2+]C(C3)C)n(cc(c2=O)C(=O)[O-])C4CC4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC1CN(CC[NH2+]1)c2c(cc3c(c2OC)n(cc(c3=O)C(=O)[O-])C4CC4)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CO/N=C/1\CN(CC1C[NH3+])c2c(cc3c(=O)c(cn(c3n2)C4CC4)C(=O)[O-])F Clinical Trial Toxicity:
<boolean>Yes</boolean>
CO/N=C/1\CN(CC1C[NH3+])c2c(cc3c(=O)c(cn(c3n2)C4CC4)C(=O)[O-])F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+]1[C@@H]2CC[C@H]1C[C@H](C2)OC(=O)C(CO)c3ccccc3 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)[N+]1([C@@H]2CC[C@@H]1CC(C2)OC(=O)C(CO)c3ccccc3)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+]1[C@@H]2C[C@H](C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+]1C2CC(CC1C3C2O3)OC(=O)C(CO)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[N+]1(C2CCC1CC(C2)OC(=O)C(c3ccccc3)O)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[N+]1(C2CCC1CC(C2)OC(=O)C(c3ccccc3)O)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)CC[C@@H](C(=O)[O-])[NH2+][C@@H](CCCC[NH3+])C(=O)N2CCC[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@@H](C(=O)N1CCC[C@H]1C(=O)[O-])[NH2+][C@@H](CCc2ccccc2)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2[C@H]3CCC[C@H]3C[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2[C@H]3CCCC[C@@H]3C[C@H]2C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2CCC[C@H]2C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCOC(=O)[C@H](CCc1ccccc1)[NH2+][C@@H](C)C(=O)N2CCC[C@H]2C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)C2(CC[NH+](CC2)CCC(C#N)(c3ccccc3)c4ccccc4)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCOC(=O)C1(CC[NH+](CC1)CCC(C#N)(c2ccccc2)c3ccccc3)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CN(C)C(=O)C(CC[NH+]1CCC(CC1)(c2ccc(cc2)Cl)O)(c3ccccc3)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)(c1ccc(cc1)C(CCC[NH+]2CCC(CC2)C(c3ccccc3)(c4ccccc4)O)O)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1ccc2c(c1)[nH]c(=O)n2C3CC[NH+](CC3)CCCC(c4ccc(cc4)F)c5ccc(cc5)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1ccc2c(c1)[nH]c(=O)n2C3CC[NH+](CC3)CCCC(c4ccc(cc4)F)c5ccc(cc5)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)COc2ccc(cc2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH2+]CCC(c1ccccc1)Oc2ccc(cc2)C(F)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(COc1ccccc1)[NH+](CCCl)Cc2ccccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+](CCc1ccc(cc1)NS(=O)(=O)C)CCOc2ccc(cc2)NS(=O)(=O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1ccccc1O[C@H](CC[NH2+]C)c2ccccc2 Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1ccccc1O[C@H](CC[NH2+]C)c2ccccc2
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+](C)CCC=C1c2ccccc2CCc3c1cccc3 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+](C)CC/C=C\1/c2ccccc2Sc3c1cc(cc3)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(C)[NH2+]CCCC1(c2ccccc2-c3c1cccc3)C(=O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)[N+](C)(CCOC(=O)C1c2ccccc2Oc3c1cccc3)C(C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+](C)CC/C=C\1/c2ccccc2COc3c1cc(cc3)CC(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+](C)CC/C=C\1/c2ccccc2COc3c1cc(cc3)CC(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1c(c(c(c2c1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)C)OC(=O)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: Cc1c(c2c(c(c1O)C)CC[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C#CC[NH2+][C@@H]1CCc2c1cccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)(C)[NH2+]CC(COc1cccc2c1C[C@@H]([C@@H](C2)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1c(c(c(c2c1O[C@](CC2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)OC(=O)C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1c(c(c(c2c1O[C@](CC2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)OC(=O)C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCCC[NH+]1C[C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCCCCCCCC[NH+]1C[C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C1CC(C1)(C(=O)O)C(=O)O.N.N.[Pt] Clinical Trial Toxicity: <boolean>No</boolean> Target Molecule (Smiles): C1[C@@H]([C@H]([C@@H]([C@H]([NH+]1CCO)CO)O)O)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C1[C@@H]([C@H]([C@@H]([C@H]([NH+]1CCO)CO)O)O)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)C2C[C@H]2[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCN(CC)C(=O)[C@@]1(C[C@@H]1C[NH3+])c2ccccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(C)CC(C1(CCC1)c2ccc(cc2)Cl)[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)(C)[NH2+]C[C@@H](COc1ccccc1C2CCCC2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCOC(=O)C1(CC[NH+](CC1)C)c2ccccc2 Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCOC(=O)C1(CC[NH+](CC1)C)c2ccccc2
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O Clinical Trial Toxicity:
<boolean>No</boolean>
CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+](CCc1ccc(cc1)NS(=O)(=O)C)CCOc2ccc(cc2)NS(=O)(=O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(COc1ccccc1)[NH+](CCCl)Cc2ccccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@@H]([C@@H](c1ccc(cc1)O)O)[NH2+]CCc2ccc(cc2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@H](Cc1ccc(cc1)OC)[NH2+]C[C@@H](c2ccc(c(c2)NC=O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCOc1ccccc1OCC[NH2+][C@H](C)Cc2ccc(c(c2)S(=O)(=O)N)OC Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCOc1ccccc1OCC[NH2+][C@H](C)Cc2ccc(c(c2)S(=O)(=O)N)OC
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): Cl[Cr](Cl)Cl Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cl[Cr](Cl)Cl
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: c1ccc2c(c1)C(=O)N(C2=O)C3CCC(=O)NC3=O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3N Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: c1cc2c(c(c1)N)CN(C2=O)C3CCC(=O)NC3=O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N Clinical Trial Toxicity:
<boolean>No</boolean>
C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1c(c(=O)n2c(n1)C(CCC2)O)CC[NH+]3CCC(CC3)c4c5ccc(cc5on4)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCCCCCCCCCCCCCCC(=O)O[C@@H]1CCCn2c1nc(c(c2=O)CC[NH+]3CCC(CC3)c4c5ccc(cc5on4)F)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC1=C(C(=O)N2CCCCC2=N1)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: CC(=O)c1ccc(c(c1)OC)OCCC[NH+]2CCC(CC2)c3c4ccc(cc4on3)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1c(c(=O)n2c(n1)CCCC2)CC[NH+]3CCC(CC3)c4c5ccc(cc5on4)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1c(c(=O)n2c(n1)CCCC2)CC[NH+]3CCC(CC3)c4c5ccc(cc5on4)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(ccc1[C@H]([C@@H](COC(=O)CCC(=O)[O-])NC(=O)[C-](Cl)Cl)O)[N+](=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(ccc1[C@H]([C@@H](COC(=O)CCC(=O)[O-])NC(=O)[C-](Cl)Cl)O)[N+](=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C(C)(C)C)O)C)O)F)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@H]1C(=O)COC(=O)C(C)(C)C)C)O)Cl)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@H]3[C@H](C[C@@]2([C@]1(C(=O)COC(=O)C)O)C)O)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)C(=O)CO Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCC(=O)O[C@@]1([C@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)C(=O)CO
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1c(cc(c(c1I)Oc2cc(c(c(c2)I)[O-])I)I)C[C@@H](C(=O)[O-])[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1c(cc(c(c1I)Oc2cc(c(c(c2)I)[O-])I)I)C[C@H](C(=O)[O-])[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1cc(c(cc1Cl)O)Oc2ccc(cc2Cl)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(c1cccc(c1)Oc2ccccc2)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(c(cc1Oc2c(cc(cc2I)C[C@@H](C(=O)[O-])[NH3+])I)I)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(c(cc1Oc2c(cc(cc2I)C[C@@H](C(=O)[O-])[NH3+])I)I)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1cc(c(cc1F)F)n2cc(c(=O)c3c2nc(c(c3)F)N4C[C@@H]5[C@H](C4)[C@H]5[NH3+])C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@@H](C(=O)N[C@@H](C)C(=O)NC1[C@H]2[C@@H]1CN(C2)c3c(cc4c(=O)c(cn(c4n3)c5ccc(cc5F)F)C(=O)[O-])F)[NH3+] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@@H](C(=O)N[C@@H](C)C(=O)NC1[C@H]2[C@@H]1CN(C2)c3c(cc4c(=O)c(cn(c4n3)c5ccc(cc5F)F)C(=O)[O-])F)[NH3+]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+]1CCC(=C2c3ccccc3CC(=O)c4c2ccs4)CC1 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1cc2c(nc1)C(=C3CC[NH2+]CC3)c4ccc(cc4CC2)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+]1CCC(=C2c3ccccc3CCc4c2nccc4)CC1 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH2+]CCCC1c2ccccc2C=Cc3c1cccc3 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+]1CCC(=C2c3ccccc3C=Cc4c2cccc4)CC1 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+]1CCC(=C2c3ccccc3C=Cc4c2cccc4)CC1
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1S(=O)(=O)N)Cl)Cl)S(=O)(=O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity:
<boolean>No</boolean>
B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCCCCCOC(=O)CCC(=O)C[NH3+] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCCCOC(=O)CCC(=O)C[NH3+]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C(C)(C)C)O)C)O)F)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@H]1C(=O)COC(=O)C(C)(C)C)C)O)Cl)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@H]3[C@H](C[C@@]2([C@]1(C(=O)COC(=O)C)O)C)O)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC(C)(C)C)CC[C@@H]4[C@@]3(C=CC(=O)N4)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC(C)(C)C)CC[C@@H]4[C@@]3(C=CC(=O)N4)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1c(c(c(c(c1C(=O)[O-])I)NC(=O)C)I)C(=O)NC Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1c(c(c(c(c1C(=O)[O-])I)NC(=O)C)I)C(=O)NC
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C(C[NH3+])C(O)(P(=O)([O-])[O-])P(=O)([O-])[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C(C[NH3+])C(O)(P(=O)([O-])[O-])P(=O)([O-])[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCOC(=O)C1(CC[NH+](CC1)CCC(C#N)(c2ccccc2)c3ccccc3)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CN(C)C(=O)C(CC[NH+]1CCC(CC1)(c2ccc(cc2)Cl)O)(c3ccccc3)c4ccccc4 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(C)(c1ccc(cc1)C(CCC[NH+]2CCC(CC2)C(c3ccccc3)(c4ccccc4)O)O)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc2c(c1)[nH]c(=O)n2C3CC[NH+](CC3)CCCC(c4ccc(cc4)F)c5ccc(cc5)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1ccc(cc1)C2(CC[NH+](CC2)CCC(C#N)(c3ccccc3)c4ccccc4)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1ccc(cc1)C2(CC[NH+](CC2)CCC(C#N)(c3ccccc3)c4ccccc4)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1cn(c(=O)nc1N)C[C@@H](CO)OCP(=O)([O-])[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1c(c([nH]c(=O)n1)N)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1c(c([nH]c(=O)n1)N)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1c(c(c(c2c1O[C@](CC2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)OC(=O)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: Cc1c(c(c(c2c1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)C)OC(=O)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: Cc1c(c2c(c(c1O)C)CC[C@@](O2)(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2 Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)C2=NCc3nncn3-c4c2cc(cc4)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: Cc1nnc2n1-c3ccc(cc3C(=NC2)c4ccccc4Cl)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: Cc1[nH+]cc2n1-c3ccc(cc3C(=NC2)c4ccccc4F)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc(cc1)C2=NCC(=O)N(c3c2cc(cc3)Cl)CC4CC4 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1nnc2n1-c3ccc(cc3C(=NC2)c4ccccc4)Cl Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1nnc2n1-c3ccc(cc3C(=NC2)c4ccccc4)Cl
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCOCCn1c2ccccc2nc1N3CCC[NH+](CC3)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCOCCn1c2ccccc2nc1N3CCC[NH+](CC3)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)OC Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@H]3[C@H]1C5)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C=CC[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@H]3[C@H]1C5)OC Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@H]3[C@H]1C5)OC
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1c2c(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)NC(N2)C(Cl)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1c2c(cc(c1Cl)S(=O)(=O)N)S(=O)(=O)NCN2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CN1C(Nc2cc(c(cc2S1(=O)=O)S(=O)(=O)N)Cl)CCl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CN1C(Nc2cc(c(cc2S1(=O)=O)S(=O)(=O)N)Cl)CSCC(F)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCC1Nc2cc(c(cc2C(=O)N1)S(=O)(=O)N)Cl Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCC1Nc2cc(c(cc2C(=O)N1)S(=O)(=O)N)Cl
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C/C=C/C1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccc(cc3)O)[NH3+])SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc(cc1)[C@H](C(=O)N[C@H]2[C@H]3CCC(=C(N3C2=O)C(=O)[O-])Cl)[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)Cc3cccs3)SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](c3ccc(cc3)O)[NH3+])C(=O)[O-])C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)[NH3+])SC1)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)[NH3+])SC1)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C1CN1P(=S)(N2CC2)N3CC3 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C1CN1P(=S)(N2CC2)N3CC3
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)C(=O)c2ccc3n2CCC3C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)(C)[NH2+]C[C@@H](COc1cccc2c1CCCC2=O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(c(cc1C(F)(F)F)[N+](=O)[O-])C(=O)[C-]2C(=O)CCCC2=O Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(c(cc1C(F)(F)F)[N+](=O)[O-])C(=O)[C-]2C(=O)CCCC2=O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCC(=O)O[C@](Cc1ccccc1)(c2ccccc2)[C@H](C)C[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@H](Cc1ccc(c(c1)O)O)[C@@H](C)Cc2ccc(c(c2)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(c(c(c1Cl)Cl)Cc2c(c(cc(c2Cl)Cl)Cl)O)O)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc(c(c1)C(c2ccc(cc2)Cl)C(Cl)Cl)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCC(=O)O[C@@](Cc1ccccc1)(c2ccccc2)[C@@H](C)C[NH+](C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCC(=O)O[C@@](Cc1ccccc1)(c2ccccc2)[C@@H](C)C[NH+](C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC Clinical Trial Toxicity: <boolean>No</boolean> Example 3: Smiles: COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC.Cl Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: COCCOc1cc2c(cc1OCCOC)ncnc2Nc3cccc(c3)C#C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CS(=O)(=O)CCNCc1ccc(o1)c2ccc3c(c2)c(ncn3)Nc4ccc(c(c4)Cl)OCc5cccc(c5)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
CS(=O)(=O)CCNCc1ccc(o1)c2ccc3c(c2)c(ncn3)Nc4ccc(c(c4)Cl)OCc5cccc(c5)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CCC1(CC(=O)NC1=O)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCC1(CC(=O)NC1=O)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(O)(P(=O)([O-])[O-])P(=O)([O-])[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(c(c1)CC(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CSc4nnnn4CC(=O)[O-])C(=O)[O-])C[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc(cc1)[C@H](C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CSc4nnnn4CS(=O)(=O)[O-])C(=O)[O-])O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: Cn1c(nnn1)SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)[C@@H](c4ccccc4)O)SC2)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+](C)CCn1c(nnn1)SCC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)Cc4csc(n4)N)SC2)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cn1c(nnn1)SCC2=C(N3[C@@H]([C@@](C3=O)(NC(=O)C(c4ccc(cc4)O)C(=O)[O-])OC)OC2)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cn1c(nnn1)SCC2=C(N3[C@@H]([C@@](C3=O)(NC(=O)C(c4ccc(cc4)O)C(=O)[O-])OC)OC2)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc2c(c1)c3c([nH]2)CN(CC3)C(=O)CCS Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCc1cccc2c1[nH]c3c2CCOC3(CC)CC(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(C)(C)[NH2+]CC(COc1cccc2c1C[C@@H]([C@@H](C2)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc2c(c1)c(c3c([nH+]2)CCCC3)N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH2+][C@@H]1CCc2c(c3cc(ccc3[nH]2)C(=O)N)C1 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH2+][C@@H]1CCc2c(c3cc(ccc3[nH]2)C(=O)N)C1
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C(C)(C)C)O)C)O)F)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@H]1C(=O)COC(=O)C(C)(C)C)C)O)Cl)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@@H]1C[C@H]2[C@@H]3C[C@@H](C4=CC(=O)C=C[C@@]4([C@H]3[C@H](C[C@@]2([C@]1(C(=O)COC(=O)C)O)C)O)C)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CO)O)C)O)F)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)CO)O)CCC4=CC(=O)C=C[C@]34C)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@]12C[C@@H]([C@H]3[C@H]([C@@H]1CC[C@@]2(C(=O)CO)O)CCC4=CC(=O)C=C[C@]34C)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[N+]1(CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5c6c(cc(c5OC)OC)CC[N+]([C@@H]6Cc7ccc(c(c7)O3)OC)(C)C)OC)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+]1CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5c6c(cc(c5O)OC)CC[N+]([C@@H]6Cc7ccc(c(c7)O3)O)(C)C)OC Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+]1CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5c6c(cc(c5O)OC)CC[N+]([C@@H]6Cc7ccc(c(c7)O3)O)(C)C)OC
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C(OC(C(F)(F)F)C(F)(F)F)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
C(OC(C(F)(F)F)C(F)(F)F)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)NO Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: c1cc(c(cc1[N+](=O)[O-])Cl)NC(=O)c2cc(ccc2O)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(=O)N(C)c1c(c(c(c(c1I)C(=O)NCC(=O)Nc2c(c(c(c(c2I)C(=O)[O-])I)C(=O)NCCO)I)I)C(=O)NC)I Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CN(c1c(c(c(c(c1I)C(=O)NC(CO)C(CO)O)I)C(=O)NC(CO)C(CO)O)I)C(=O)CC(=O)N(C)c2c(c(c(c(c2I)C(=O)NC(CO)C(CO)O)I)C(=O)NC(CO)C(CO)O)I Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(CS(=O)(=O)c1ccc(cc1)F)(C(=O)Nc2ccc(c(c2)C(F)(F)F)C#N)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(CS(=O)(=O)c1ccc(cc1)F)(C(=O)Nc2ccc(c(c2)C(F)(F)F)C#N)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(c(c1)C2=NC(C(=O)Nc3c2cc(cc3)Cl)O)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc(c(c1)C2=NCC(=O)Nc3c2cc(cc3)[N+](=O)[O-])Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccc(cc1)C2=NC(C(=O)Nc3c2cc(cc3)Cl)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc(cc1)C2=NC(C(=O)Nc3c2cc(cc3)Cl)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1ccccc1N2C(Nc3cc(c(cc3C2=O)S(=O)(=O)N)Cl)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1ccccc1N2C(Nc3cc(c(cc3C2=O)S(=O)(=O)N)Cl)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)(C#N)c1cc(cc(c1)C(C)(C)C#N)Cn2cncn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)(C#N)C1=CC(=CC(=C1)CN2C=NC=N2)C(C)(C)C#N Clinical Trial Toxicity: <boolean>No</boolean> Example 3: Smiles: CCOC(=O)c1cncn1C(C)c2ccccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCCCCCCCCCCCCCCC[N+](C)(C)CCN(Cc1ccc(cc1)OC)c2ncccn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1cc(c(c(c1)F)Cn2cc(nn2)C(=O)N)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cc(c(c(c1)F)Cn2cc(nn2)C(=O)N)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1cc(c2c3c1C[C@@H]4[C@]5([C@]3(CC[NH+]4CC6CC6)[C@@H](O2)C(=O)CC5)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C=C1CC[C@]2([C@H]3Cc4ccc(c5c4[C@]2([C@H]1O5)CC[NH+]3CC6CC6)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1cc(c2c3c1C[C@@H]4[C@]5([C@]3(CC[NH+]4CC6CCC6)[C@@H](O2)[C@H](CC5)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+]1CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[N+]1(CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)O)CC6CC6 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[N+]1(CC[C@]23c4c5ccc(c4O[C@H]2C(=O)CC[C@]3([C@H]1C5)O)O)CC6CC6
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(COC(=O)C4)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(C/C(=C/[O-])/C(=O)C4)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@H](C(=O)C4)C)C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@H](C(=O)C4)C)C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C[N+](C)(C)CCOC(=O)N Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[N+](C)(C)CCOC(=O)N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C(C(F)(F)F)(OC(F)F)F Clinical Trial Toxicity:
<boolean>Yes</boolean>
C(C(F)(F)F)(OC(F)F)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@H](Cc1ccc(c(c1)O)O)[C@@H](C)Cc2ccc(c(c2)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC1=C(C2=CC=CC=C2N1)CCNCC3=CC=C(C=C3)/C=C/C(=O)NO Clinical Trial Toxicity: <boolean>No</boolean> Example 3: Smiles: C[C@H](c1cccc2c1cccc2)[NH2+]CCCc3cccc(c3)C(F)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1cc(ccc1CCCC[NH2+]C[C@@H](c2ccc(c(c2)O)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(C)(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CN(CC2=CC=C(C=C2)C3=CC=CC=N3)NC(=O)[C@H](C(C)(C)C)NC(=O)OC)O)NC(=O)OC Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(C)(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CN(CC2=CC=C(C=C2)C3=CC=CC=N3)NC(=O)[C@H](C(C)(C)C)NC(=O)OC)O)NC(=O)OC
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+]1CCCCC1CCN2c3ccccc3Sc4c2cc(cc4)S(=O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+]1CCCCC1CCN2c3ccccc3Sc4c2cc(cc4)SC Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccc2c(c1)N(c3cc(ccc3S2)C(F)(F)F)CCCN4CC[NH+](CC4)CCO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1ccc2c(c1)N(c3cc(ccc3S2)Cl)CCCN4CC[NH+](CC4)CCO Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+]1CCC(C1)CN2c3ccccc3Sc4c2cccc4 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+]1CCC(C1)CN2c3ccccc3Sc4c2cccc4
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[NH+](C)CC[C@@H](c1ccc(cc1)Br)c2ccccn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+](C)CCC(c1ccc(cc1)Br)c2ccccn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+](C)CCC(c1ccc(cc1)Cl)c2ccccn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+](C)CCOC(c1ccc(cc1)Cl)c2ccccn2 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[NH+](C)CCC(c1ccccc1)c2ccccn2 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[NH+](C)CCC(c1ccccc1)c2ccccn2
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@]34C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@]2([C@H](C[C@]4([C@H]3CC[C@]4(C)O)C)O)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)CC[C@@]43C)F)O)C)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)CC[C@@]43C)F)O)C)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)(C)[NH2+]C[C@@H](COc1cccc2c1CCCC2=O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc2c(c1)C(=O)O[Bi](O2)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCC[NH+](CCC)CCc1cccc2c1CC(=O)N2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+](C)CC/C=C\1/c2ccccc2COc3c1cc(cc3)CC(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1c2c(c(c(c1OC)C/C=C(\C)/CCC(=O)[O-])[O-])C(=O)OC2 Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1c2c(c(c(c1OC)C/C=C(\C)/CCC(=O)[O-])[O-])C(=O)OC2
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)OC(=O)OC(C)OC(=O)C1=C(CS[C@H]2N1C(=O)[C@H]2NC(=O)/C(=N\OC)/c3csc(n3)N)COC Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\OC)/c3csc(n3)N)SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C=CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\O)/c3csc(n3)N)SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C=CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)/C(=N\OCC(=O)[O-])/c3csc(n3)N)SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1c(nc(s1)N)/C(=C/CC(=O)[O-])/C(=O)N[C@H]2[C@@H]3N(C2=O)C(=CCS3)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1c(nc(s1)N)/C(=C/CC(=O)[O-])/C(=O)N[C@H]2[C@@H]3N(C2=O)C(=CCS3)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@@H](CN1c2ccccc2Sc3c1cc(cc3)OC)C[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+](C)CCCN1c2ccccc2Sc3c1cc(cc3)C(F)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[NH+](C)CCCN1c2ccccc2Sc3c1cc(cc3)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[NH+](C)CCCN1c2ccccc2Sc3c1cccc3 Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(CN1c2ccccc2Sc3c1cccc3)[NH+](C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(CN1c2ccccc2Sc3c1cccc3)[NH+](C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1nc(c2c(n1)n(cn2)[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)F)N=C(N=C2N)Cl Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N=C(N=C2N)F Clinical Trial Toxicity: <boolean>No</boolean> Target Molecule (Smiles): C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2N)F Clinical Trial Toxicity:
<boolean>No</boolean>
C1=NC2=C(N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2N)F
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cc2c(s1)Nc3ccccc3[NH+]=C2N4CC[NH+](CC4)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[NH+]1CCN(CC1)C2=[NH+]c3cc(ccc3Nc4c2cccc4)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccc2c(c1)C(=[NH+]c3ccccc3S2)N4CC[NH+](CC4)CCOCCO Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1cc2=C(Nc3ccccc3N=c2s1)N4CC[NH+](CC4)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1cc2=C(Nc3ccccc3N=c2s1)N4CC[NH+](CC4)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCc1c2cc(ccc2nc-3c1Cn4c3cc5c(c4=O)COC(=O)[C@@]5(CC)O)OC(=O)N6CCC(CC6)[NH+]7CCCCC7 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC[C@@]1(c2cc-3n(c(=O)c2COC1=O)Cc4c3nc5ccc(c(c5c4)C[NH+](C)C)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCC1=C2C=C(C=CC2=NC3=C1CN4C3=CC5=C(C4=O)COC(=O)[C@@]5(CC)O)OC(=O)N6CCC(CC6)N7CCCCC7 Clinical Trial Toxicity:
<boolean>No</boolean>
CCC1=C2C=C(C=CC2=NC3=C1CN4C3=CC5=C(C4=O)COC(=O)[C@@]5(CC)O)OC(=O)N6CCC(CC6)N7CCCCC7
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCN(CC)c1ccc(cc1)C(=C2C=CC(=[N+](CC)CC)C=C2)c3cc(ccc3S(=O)(=O)[O-])S(=O)(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1cc(c(c(c1)C(=O)c2ccc(cc2)Br)N)CC(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccc(cc1)C(=O)c2cccc(c2N)CC(=O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)(C(=O)[O-])Oc1ccc(cc1)C(=O)c2ccc(cc2)Cl Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CN(C)c1ccc(cc1)C(=C2C=CC(=[N+](C)C)C=C2)c3ccc(cc3)N(C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CN(C)c1ccc(cc1)C(=C2C=CC(=[N+](C)C)C=C2)c3ccc(cc3)N(C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCOc1cc(ccc1C(=O)OCC[NH+](CC)CC)N Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCOc1cc(ccc1C(=O)OCC[NH+](CC)CC)N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): c1cnc(nc1)N2CC[NH+](CC2)CCCCN3C(=O)CC4(CCCC4)CC3=O Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1cnc(nc1)N2CC[NH+](CC2)CCCCN3C(=O)CC4(CCCC4)CC3=O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cc([nH]c1/C=C\2/c3ccccc3NC2=O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC[NH+](CC)CCNC(=O)c1c(c([nH]c1C)/C=C\2/c3cc(ccc3NC2=O)F)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCN(CC)CCNC(=O)C1=C(NC(=C1C)/C=C\2/C3=C(C=CC(=C3)F)NC2=O)C Clinical Trial Toxicity: <boolean>No</boolean> Example 4: Smiles: c1ccc2c(c1)CC(=O)c3ccccc3N2C(=O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCN(CC)CCNC(=O)C1=C(NC(=C1C)/C=C\2/C3=C(C=CC(=C3)F)NC2=O)C.C([C@@H](C(=O)O)O)C(=O)O Clinical Trial Toxicity:
<boolean>No</boolean>
CCN(CC)CCNC(=O)C1=C(NC(=C1C)/C=C\2/C3=C(C=CC(=C3)F)NC2=O)C.C([C@@H](C(=O)O)O)C(=O)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cccc(c1NC(=O)C2CCCC[NH+]2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCC[NH+]1CCCC[C@H]1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCCC[NH+]1CCCC[C@H]1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCCC[NH+]1CCCCC1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H]([NH2+]C3)C(=O)Nc4cccc(c4)C(=O)[O-])C(=O)[O-])[C@@H](C)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H]([NH2+]C3)C(=O)Nc4cccc(c4)C(=O)[O-])C(=O)[O-])[C@@H](C)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1ccc(cc1)C(CC[NH+]2CCCC2)(C3CCCCC3)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc(cc1)C(CC[NH+]2CCCCC2)(C3CCCCC3)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccc(cc1)C(CC[NH+]2CCCCC2)(C3CC4CC3C=C4)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[N+]1(CCN(CC1)CC(c2ccccc2)(C3CCCCC3)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1ccc(cc1)C(CC[NH+]2CCCCC2)(C3CCCC3)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1ccc(cc1)C(CC[NH+]2CCCCC2)(C3CCCC3)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): COC(CNC(=O)N)C[Hg]Cl Clinical Trial Toxicity:
<boolean>Yes</boolean>
COC(CNC(=O)N)C[Hg]Cl
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C1C(N(C2=C(N1)NC(=NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: c1cc(ccc1C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])NC[C@H]2CNc3c(c(=O)nc([nH]3)N)N2C=O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1cc(ccc1C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])NCC2CNc3c(c(=O)nc([nH]3)N)N2C=O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CN1c2c([nH]c(nc2=O)N)NC[C@@H]1CNc3ccc(cc3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C1C(N(C2=C(N1)NC(=NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Ca+2] Clinical Trial Toxicity:
<boolean>No</boolean>
C1C(N(C2=C(N1)NC(=NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Ca+2]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC#CCC(C)[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C/CCCC(=O)[O-])/C2)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)(C)[NH2+]CC(COc1cccc2c1C[C@@H]([C@@H](C2)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C#CC[NH2+][C@@H]1CCc2c1cccc2 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@]12CC[C@@H]3c4ccc(cc4C[C@H]([C@H]3[C@@H]1CC[C@@H]2O)CCCCCCCCCS(=O)CCCC(C(F)(F)F)(F)F)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCCC[C@H](CC[C@H]1[C@@H]2Cc3cccc(c3C[C@@H]2C[C@@H]1O)OCC(=O)[O-])O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCC[C@H](CC[C@H]1[C@@H]2Cc3cccc(c3C[C@@H]2C[C@@H]1O)OCC(=O)[O-])O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1c(c(no1)c2c(cccc2Cl)Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: Cc1c(c(no1)c2ccccc2)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)c3c(cccc3OC)OC)C(=O)[O-])C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCOc1ccc2ccccc2c1C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1c(c(no1)c2ccccc2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1c(c(no1)c2ccccc2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCCSc1ccc2c(c1)nc([nH]2)NC(=O)OC Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CN1C2=C(C=C(C=C2)N(CCCl)CCCl)N=C1CCCC(=O)O.Cl Clinical Trial Toxicity: <boolean>No</boolean> Example 3: Smiles: Cn1c2ccc(cc2nc1CCCC(=O)[O-])N(CCCl)CCCl Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(C)Cn1cnc2c1c3ccccc3nc2N Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(C)Cn1cnc2c1c3ccccc3nc2N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCCc1c2c(c(=O)[nH]c(n2)c3cc(ccc3OCC)S(=O)(=O)N4CC[NH+](CC4)C)n(n1)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCc1nc(c2n1[nH]c(nc2=O)c3cc(ccc3OCC)S(=O)(=O)N4CC[NH+](CC4)CC)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCc1nc(c2n1[nH]c(nc2=O)c3cc(ccc3OCC)S(=O)(=O)N4CC[NH+](CC4)CC)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)C[C@@H](C(=O)N[C@@H](CCCNC(=[NH2+])N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N)NC(=O)CNC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc3c[nH]c4c3cccc4)NC(=O)[C@H](Cc5c[nH]cn5)NC(=O)[C@@H]6CCC(=O)N6 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=[NH2+])N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2cn(cn2)Cc3ccccc3)NC(=O)[C@H](Cc4ccc(cc4)O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc5c[nH]c6c5cccc6)NC(=O)[C@H](Cc7cnc[nH]7)NC(=O)[C@@H]8CCC(=O)N8 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(C)C[C@@H](C(=O)N[C@@H](CCC[NH+]=C(N)N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N)NC(=O)[C@@H](Cc2c[nH]c3c2cccc3)NC(=O)[C@H](Cc4ccc(cc4)O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc5c[nH]c6c5cccc6)NC(=O)[C@H](Cc7cnc[nH]7)NC(=O)[C@@H]8CCC(=O)N8 Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)NNC(=O)N)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@@H]6CCC(=O)N6 Clinical Trial Toxicity: <boolean>No</boolean> Target Molecule (Smiles): CC(C)CC(C(=O)NC(CCCNC(=[NH2+])N)C(=O)N1CCCC1C(=O)NCC(=O)N)NC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(Cc4ccc(cc4)O)NC(=O)C(CO)NC(=O)C(Cc5c[nH]c6c5cccc6)NC(=O)C(Cc7c[nH]cn7)NC(=O)C8CCC(=O)N8 Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(C)CC(C(=O)NC(CCCNC(=[NH2+])N)C(=O)N1CCCC1C(=O)NCC(=O)N)NC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(Cc4ccc(cc4)O)NC(=O)C(CO)NC(=O)C(Cc5c[nH]c6c5cccc6)NC(=O)C(Cc7c[nH]cn7)NC(=O)C8CCC(=O)N8
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@H](C(=O)C4)C)C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(COC(=O)C4)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(C/C(=C/[O-])/C(=O)C4)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@H](CCC(=O)[O-])[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: c1cnc(nc1)[N-]S(=O)(=O)c2ccc(cc2)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: COc1cnc(nc1)[N-]S(=O)(=O)c2ccc(cc2)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1ccnc(c1)[N-]S(=O)(=O)c2ccc(cc2)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: COc1c(ncnc1OC)[N-]S(=O)(=O)c2ccc(cc2)N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): Cc1ccnc(n1)[N-]S(=O)(=O)c2ccc(cc2)N Clinical Trial Toxicity:
<boolean>Yes</boolean>
Cc1ccnc(n1)[N-]S(=O)(=O)c2ccc(cc2)N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(C)[NH2+]CC(COc1ccc(cc1)CC(=O)N)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(C)[NH2+]CC(COc1ccc(cc1)CC(=O)N)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: Cc1cccc(c1NC(=O)C2CCCC[NH+]2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCC[NH+]1CCCC[C@H]1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCCC[NH+]1CCCCC1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1cc(c(cc1OCC(F)(F)F)C(=O)NCC2CCCC[NH2+]2)OCC(F)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCC[NH+]1CCCC[C@H]1C(=O)Nc2c(cccc2C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCC[NH+]1CCCC[C@H]1C(=O)Nc2c(cccc2C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@]34C Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@]2([C@H](C[C@]4([C@H]3CC[C@]4(C)O)C)O)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)COC(=O)CCC(=O)[O-])O)C)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34 Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): C1CC2(C1)C(=O)O[Pt]OC2=O Clinical Trial Toxicity:
<boolean>Yes</boolean>
C1CC2(C1)C(=O)O[Pt]OC2=O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CCCCC(C)(C/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)OC)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)[O-])O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C([C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)O)O)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)[O-])O)O Clinical Trial Toxicity:
<boolean>Yes</boolean>
CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1C/C=C\CCCC(=O)[O-])O)O
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CS(=O)(=O)O.C1CO[P@@](=O)(O[C@@H]1C2=CC(=CC=C2)Cl)COCCN3C=NC4=C3N=CN=C4N Clinical Trial Toxicity:
<boolean>No</boolean>
CS(=O)(=O)O.C1CO[P@@](=O)(O[C@@H]1C2=CC(=CC=C2)Cl)COCCN3C=NC4=C3N=CN=C4N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C/C=C/C1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccc(cc3)O)[NH3+])SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: c1ccc(cc1)[C@H](C(=O)N[C@H]2[C@H]3CCC(=C(N3C2=O)C(=O)[O-])Cl)[NH3+] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)Cc3cccs3)SC1)C(=O)[O-] Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](c3ccc(cc3)O)[NH3+])C(=O)[O-])C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)[NH3+])SC1)C(=O)[O-] Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)[NH3+])SC1)C(=O)[O-]
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: CC(C)n1c2ccccc2c(c1/C=C/[C@@H](C[C@@H](CC(=O)[O-])O)O)c3ccc(cc3)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 2: Smiles: CC(C)COC(=O)NCCC(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)[O-])C(=O)N[C@@H](Cc3ccccc3)C(=O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: CCOC(=O)Nc1ccc(cc1N)NCc2ccc(cc2)F Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: CCC(=O)O[C@@](Cc1ccccc1)(c2ccccc2)[C@@H](C)C[NH+](C)C Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): CC1=C(C2=CC=CC=C2N1)CCNCC3=CC=C(C=C3)/C=C/C(=O)NO Clinical Trial Toxicity:
<boolean>No</boolean>
CC1=C(C2=CC=CC=C2N1)CCNCC3=CC=C(C=C3)/C=C/C(=O)NO
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Target Molecule (Smiles): CC#CCn1c2c(nc1N3CCC[C@H](C3)[NH3+])n(c(=O)n(c2=O)Cc4nc(c5ccccc5n4)C)C Clinical Trial Toxicity:
<boolean>Yes</boolean>
CC#CCn1c2c(nc1N3CCC[C@H](C3)[NH3+])n(c(=O)n(c2=O)Cc4nc(c5ccccc5n4)C)C
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: C1[C@@H]([C@H](O[C@H]1N2C=NC(=NC2=O)N)CO)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: c1nc(nc(=O)n1[C@H]2C[C@@H]([C@H](O2)CO)O)N Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: C1=CN(C(=O)N=C1N)[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)O Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): c1nc(nc(=O)n1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N Clinical Trial Toxicity:
<boolean>Yes</boolean>
c1nc(nc(=O)n1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N
scaffold
4
smiles
You are an expert chemist, your task is to predict the property of molecule using your experienced chemical property prediction knowledge. Task Description: Given the Smiles string and molecular properties above, predict whether this molecule would be toxic in clinical trials (Yes) or not toxic (No). Consider all molecular properties provided, especially the potential toxicity indicators, electronic configurations, and overall molecular structure. You are also provided with an image for the target molecule which you need to take in account for analysis like a chemist does and provide the final conclusion considering the image as well. Examples: Example 1: Smiles: B([C@H](CC(C)C)NC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl)(O)O Clinical Trial Toxicity: <boolean>No</boolean> Example 2: Smiles: C(CO)N(c1c(c(c(c(c1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO Clinical Trial Toxicity: <boolean>Yes</boolean> Example 3: Smiles: c1c(c(cc(c1Cl)Cl)Cl)OCC#CI Clinical Trial Toxicity: <boolean>Yes</boolean> Example 4: Smiles: c1c(cc(c(c1NC(=O)C(=O)[O-])Cl)NC(=O)C(=O)[O-])C#N Clinical Trial Toxicity: <boolean>Yes</boolean> Target Molecule (Smiles): C[C@@H]([C@@H](c1ccc(c(c1)O)O)O)[NH3+] Clinical Trial Toxicity:
<boolean>Yes</boolean>
C[C@@H]([C@@H](c1ccc(c(c1)O)O)O)[NH3+]
scaffold
4
smiles